C31H37N9O5 — CID 25264704
N-[(1S,2R,3S,4R)-4-[6-[4-[2-[4-[2-(2-aminoethylamino)-2-oxoethyl]anilino]-2-oxoethyl]anilino]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide (PubChem CID 25264704) has the molecular formula C31H37N9O5 and a molecular weight of 615.70 g/mol. Its IUPAC name is N-[(1S,2R,3S,4R)-4-[6-[4-[2-[4-[2-(2-aminoethylamino)-2-oxoethyl]anilino]-2-oxoethyl]anilino]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide.
| Compound Name | N-[(1S,2R,3S,4R)-4-[6-[4-[2-[4-[2-(2-aminoethylamino)-2-oxoethyl]anilino]-2-oxoethyl]anilino]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide |
|---|---|
| PubChem CID | 25264704 |
| Molecular Formula | C31H37N9O5 |
| Molecular Weight | 615.70 g/mol |
| Exact Mass | 615.29 |
| IUPAC Name | N-[(1S,2R,3S,4R)-4-[6-[4-[2-[4-[2-(2-aminoethylamino)-2-oxoethyl]anilino]-2-oxoethyl]anilino]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide |
| SMILES | CCC(=O)N[C@H]1C[C@@H](n2cnc3c(Nc4ccc(CC(=O)Nc5ccc(CC(=O)NCCN)cc5)cc4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C31H37N9O5/c1-2-24(41)39-22-15-23(29(45)28(22)44)40-17-36-27-30(34-16-35-31(27)40)38-21-9-5-19(6-10-21)14-26(43)37-20-7-3-18(4-8-20)13-25(42)33-12-11-32/h3-10,16-17,22-23,28-29,44-45H,2,11-15,32H2,1H3,(H,33,42)(H,37,43)(H,39,41)(H,34,35,38)/t22-,23+,28+,29-/m0/s1 |
| InChIKey | GWJJXROBCQIMCA-LAVAFMAYSA-N |
| XLogP | 0.93 |
| TPSA | 209.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.70 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |