C25H39N7O7 — CID 110145508
tert-butyl (2R)-5-[[(1S,2S,3R,4R)-2,3-dihydroxy-4-[6-(methylamino)purin-9-yl]cyclopentyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate (PubChem CID 110145508) has the molecular formula C25H39N7O7 and a molecular weight of 549.63 g/mol. Its IUPAC name is tert-butyl (2R)-5-[[(1S,2S,3R,4R)-2,3-dihydroxy-4-[6-(methylamino)purin-9-yl]cyclopentyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate.
| Compound Name | tert-butyl (2R)-5-[[(1S,2S,3R,4R)-2,3-dihydroxy-4-[6-(methylamino)purin-9-yl]cyclopentyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 110145508 |
| Molecular Formula | C25H39N7O7 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.29 |
| IUPAC Name | tert-butyl (2R)-5-[[(1S,2S,3R,4R)-2,3-dihydroxy-4-[6-(methylamino)purin-9-yl]cyclopentyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
| SMILES | CNc1ncnc2c1ncn2[C@@H]1C[C@H](NC(=O)CC[C@@H](NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H39N7O7/c1-24(2,3)38-22(36)13(31-23(37)39-25(4,5)6)8-9-16(33)30-14-10-15(19(35)18(14)34)32-12-29-17-20(26-7)27-11-28-21(17)32/h11-15,18-19,34-35H,8-10H2,1-7H3,(H,30,33)(H,31,37)(H,26,27,28)/t13-,14+,15-,18+,19-/m1/s1 |
| InChIKey | UONLDYFMKKDNMD-WCVDCBDPSA-N |
| XLogP | 1.03 |
| TPSA | 189.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |