C15H19F2NO — CID 167792579
N-(2-benzylcyclohexyl)-2,2-difluoroacetamide (PubChem CID 167792579) has the molecular formula C15H19F2NO and a molecular weight of 267.32 g/mol. Its IUPAC name is N-(2-benzylcyclohexyl)-2,2-difluoroacetamide.
| Compound Name | N-(2-benzylcyclohexyl)-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 167792579 |
| Molecular Formula | C15H19F2NO |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | N-(2-benzylcyclohexyl)-2,2-difluoroacetamide |
| SMILES | O=C(NC1CCCCC1Cc1ccccc1)C(F)F |
| InChI | InChI=1S/C15H19F2NO/c16-14(17)15(19)18-13-9-5-4-8-12(13)10-11-6-2-1-3-7-11/h1-3,6-7,12-14H,4-5,8-10H2,(H,18,19) |
| InChIKey | LFVALVJILLQGDP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |