C22H24ClNO — CID 14965454
(E)-N-(2-benzylcyclohexyl)-3-(4-chlorophenyl)prop-2-enamide (PubChem CID 14965454) has the molecular formula C22H24ClNO and a molecular weight of 353.89 g/mol. Its IUPAC name is (E)-N-(2-benzylcyclohexyl)-3-(4-chlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(2-benzylcyclohexyl)-3-(4-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 14965454 |
| Molecular Formula | C22H24ClNO |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | (E)-N-(2-benzylcyclohexyl)-3-(4-chlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)NC1CCCCC1Cc1ccccc1 |
| InChI | InChI=1S/C22H24ClNO/c23-20-13-10-17(11-14-20)12-15-22(25)24-21-9-5-4-8-19(21)16-18-6-2-1-3-7-18/h1-3,6-7,10-15,19,21H,4-5,8-9,16H2,(H,24,25)/b15-12+ |
| InChIKey | AEHQIEYXHHJUJK-NTCAYCPXSA-N |
| XLogP | 5.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|