C17H25NO3S — CID 96532946
(2R)-N-[(1R,2R)-2-benzylcyclohexyl]-2-methylsulfonylpropanamide (PubChem CID 96532946) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is (2R)-N-[(1R,2R)-2-benzylcyclohexyl]-2-methylsulfonylpropanamide.
| Compound Name | (2R)-N-[(1R,2R)-2-benzylcyclohexyl]-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 96532946 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (2R)-N-[(1R,2R)-2-benzylcyclohexyl]-2-methylsulfonylpropanamide |
| SMILES | C[C@H](C(=O)N[C@@H]1CCCC[C@@H]1Cc1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C17H25NO3S/c1-13(22(2,20)21)17(19)18-16-11-7-6-10-15(16)12-14-8-4-3-5-9-14/h3-5,8-9,13,15-16H,6-7,10-12H2,1-2H3,(H,18,19)/t13-,15-,16-/m1/s1 |
| InChIKey | UJXUGOZKPUXPST-FVQBIDKESA-N |
| XLogP | 2.34 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |