C20H31ClN2O — CID 119773377
3-amino-N-(2-benzylcyclohexyl)cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119773377) has the molecular formula C20H31ClN2O and a molecular weight of 350.93 g/mol. Its IUPAC name is 3-amino-N-(2-benzylcyclohexyl)cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-(2-benzylcyclohexyl)cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119773377 |
| Molecular Formula | C20H31ClN2O |
| Molecular Weight | 350.93 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 3-amino-N-(2-benzylcyclohexyl)cyclohexane-1-carboxamide;hydrochloride |
| SMILES | Cl.NC1CCCC(C(=O)NC2CCCCC2Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H30N2O.ClH/c21-18-11-6-10-17(14-18)20(23)22-19-12-5-4-9-16(19)13-15-7-2-1-3-8-15;/h1-3,7-8,16-19H,4-6,9-14,21H2,(H,22,23);1H |
| InChIKey | XMSWWECHPJHURS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.93 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |