C17H33ClN2O — CID 119716258
3-amino-N-(2-tert-butylcyclohexyl)cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119716258) has the molecular formula C17H33ClN2O and a molecular weight of 316.92 g/mol. Its IUPAC name is 3-amino-N-(2-tert-butylcyclohexyl)cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-(2-tert-butylcyclohexyl)cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119716258 |
| Molecular Formula | C17H33ClN2O |
| Molecular Weight | 316.92 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | 3-amino-N-(2-tert-butylcyclohexyl)cyclohexane-1-carboxamide;hydrochloride |
| SMILES | CC(C)(C)C1CCCCC1NC(=O)C1CCCC(N)C1.Cl |
| InChI | InChI=1S/C17H32N2O.ClH/c1-17(2,3)14-9-4-5-10-15(14)19-16(20)12-7-6-8-13(18)11-12;/h12-15H,4-11,18H2,1-3H3,(H,19,20);1H |
| InChIKey | GWVGLBDJSUICIO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.92 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |