C19H26N2O3 — CID 122002970
1-[(2-benzylcyclopentyl)carbamoyl]piperidine-3-carboxylic acid (PubChem CID 122002970) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 1-[(2-benzylcyclopentyl)carbamoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(2-benzylcyclopentyl)carbamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122002970 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 1-[(2-benzylcyclopentyl)carbamoyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(C(=O)NC2CCCC2Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H26N2O3/c22-18(23)16-9-5-11-21(13-16)19(24)20-17-10-4-8-15(17)12-14-6-2-1-3-7-14/h1-3,6-7,15-17H,4-5,8-13H2,(H,20,24)(H,22,23) |
| InChIKey | UUXRGJGDMQFSIK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |