C30H43ClN2O4SSi — CID 23368658
5-chloro-3-cyclohexyl-N-(3-methylbutyl)-1-(4-methylphenyl)sulfonyl-3-trimethylsilyloxy-2H-indole-2-carboxamide (PubChem CID 23368658) has the molecular formula C30H43ClN2O4SSi and a molecular weight of 591.29 g/mol. Its IUPAC name is 5-chloro-3-cyclohexyl-N-(3-methylbutyl)-1-(4-methylphenyl)sulfonyl-3-trimethylsilyloxy-2H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-cyclohexyl-N-(3-methylbutyl)-1-(4-methylphenyl)sulfonyl-3-trimethylsilyloxy-2H-indole-2-carboxamide |
|---|---|
| PubChem CID | 23368658 |
| Molecular Formula | C30H43ClN2O4SSi |
| Molecular Weight | 591.29 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | 5-chloro-3-cyclohexyl-N-(3-methylbutyl)-1-(4-methylphenyl)sulfonyl-3-trimethylsilyloxy-2H-indole-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2c3ccc(Cl)cc3C(O[Si](C)(C)C)(C3CCCCC3)C2C(=O)NCCC(C)C)cc1 |
| InChI | InChI=1S/C30H43ClN2O4SSi/c1-21(2)18-19-32-29(34)28-30(37-39(4,5)6,23-10-8-7-9-11-23)26-20-24(31)14-17-27(26)33(28)38(35,36)25-15-12-22(3)13-16-25/h12-17,20-21,23,28H,7-11,18-19H2,1-6H3,(H,32,34) |
| InChIKey | XVBNJKFLSGDAKM-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.29 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|