C23H28ClNO2S — CID 44603671
(2R)-6-chloro-2-heptyl-3-methylidene-1-(4-methylphenyl)sulfonyl-2H-indole (PubChem CID 44603671) has the molecular formula C23H28ClNO2S and a molecular weight of 418.00 g/mol. Its IUPAC name is (2R)-6-chloro-2-heptyl-3-methylidene-1-(4-methylphenyl)sulfonyl-2H-indole.
| Compound Name | (2R)-6-chloro-2-heptyl-3-methylidene-1-(4-methylphenyl)sulfonyl-2H-indole |
|---|---|
| PubChem CID | 44603671 |
| Molecular Formula | C23H28ClNO2S |
| Molecular Weight | 418.00 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | (2R)-6-chloro-2-heptyl-3-methylidene-1-(4-methylphenyl)sulfonyl-2H-indole |
| SMILES | C=C1c2ccc(Cl)cc2N(S(=O)(=O)c2ccc(C)cc2)[C@@H]1CCCCCCC |
| InChI | InChI=1S/C23H28ClNO2S/c1-4-5-6-7-8-9-22-18(3)21-15-12-19(24)16-23(21)25(22)28(26,27)20-13-10-17(2)11-14-20/h10-16,22H,3-9H2,1-2H3/t22-/m1/s1 |
| InChIKey | BMMOJVOQTUFDSP-JOCHJYFZSA-N |
| XLogP | 6.60 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.00 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|