C23H35NO2S — CID 10500564
3-methylidene-1-(4-methylphenyl)sulfonyl-2-octyl-4-propan-2-ylidenepyrrolidine (PubChem CID 10500564) has the molecular formula C23H35NO2S and a molecular weight of 389.61 g/mol. Its IUPAC name is 3-methylidene-1-(4-methylphenyl)sulfonyl-2-octyl-4-propan-2-ylidenepyrrolidine.
| Compound Name | 3-methylidene-1-(4-methylphenyl)sulfonyl-2-octyl-4-propan-2-ylidenepyrrolidine |
|---|---|
| PubChem CID | 10500564 |
| Molecular Formula | C23H35NO2S |
| Molecular Weight | 389.61 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | 3-methylidene-1-(4-methylphenyl)sulfonyl-2-octyl-4-propan-2-ylidenepyrrolidine |
| SMILES | C=C1C(=C(C)C)CN(S(=O)(=O)c2ccc(C)cc2)C1CCCCCCCC |
| InChI | InChI=1S/C23H35NO2S/c1-6-7-8-9-10-11-12-23-20(5)22(18(2)3)17-24(23)27(25,26)21-15-13-19(4)14-16-21/h13-16,23H,5-12,17H2,1-4H3 |
| InChIKey | JXRKMEFSQPCVRT-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.61 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|