C22H33NO2S — CID 11783705
3-but-3-en-2-yl-2-hexyl-4-methyl-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole (PubChem CID 11783705) has the molecular formula C22H33NO2S and a molecular weight of 375.58 g/mol. Its IUPAC name is 3-but-3-en-2-yl-2-hexyl-4-methyl-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole.
| Compound Name | 3-but-3-en-2-yl-2-hexyl-4-methyl-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 11783705 |
| Molecular Formula | C22H33NO2S |
| Molecular Weight | 375.58 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 3-but-3-en-2-yl-2-hexyl-4-methyl-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole |
| SMILES | C=CC(C)C1=C(C)CN(S(=O)(=O)c2ccc(C)cc2)C1CCCCCC |
| InChI | InChI=1S/C22H33NO2S/c1-6-8-9-10-11-21-22(18(4)7-2)19(5)16-23(21)26(24,25)20-14-12-17(3)13-15-20/h7,12-15,18,21H,2,6,8-11,16H2,1,3-5H3 |
| InChIKey | VVTPWXLSSKRKJR-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.58 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|