C21H23ClN2O6S — CID 102195897
ethyl 2-[(2S,4R,5S)-5-(4-chlorophenyl)-1-(4-methylphenyl)sulfonyl-4-nitropyrrolidin-2-yl]acetate (PubChem CID 102195897) has the molecular formula C21H23ClN2O6S and a molecular weight of 466.94 g/mol. Its IUPAC name is ethyl 2-[(2S,4R,5S)-5-(4-chlorophenyl)-1-(4-methylphenyl)sulfonyl-4-nitropyrrolidin-2-yl]acetate.
| Compound Name | ethyl 2-[(2S,4R,5S)-5-(4-chlorophenyl)-1-(4-methylphenyl)sulfonyl-4-nitropyrrolidin-2-yl]acetate |
|---|---|
| PubChem CID | 102195897 |
| Molecular Formula | C21H23ClN2O6S |
| Molecular Weight | 466.94 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | ethyl 2-[(2S,4R,5S)-5-(4-chlorophenyl)-1-(4-methylphenyl)sulfonyl-4-nitropyrrolidin-2-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1C[C@@H]([N+](=O)[O-])[C@H](c2ccc(Cl)cc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H23ClN2O6S/c1-3-30-20(25)13-17-12-19(24(26)27)21(15-6-8-16(22)9-7-15)23(17)31(28,29)18-10-4-14(2)5-11-18/h4-11,17,19,21H,3,12-13H2,1-2H3/t17-,19+,21-/m0/s1 |
| InChIKey | QUXWJDZJBDWPEZ-DSKINZAPSA-N |
| XLogP | 3.75 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.94 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|