C27H26ClN3O7S — CID 23735451
methyl 1-(4-chlorophenyl)sulfonyl-5-[(4-methylphenyl)methylcarbamoyl]-2-(2-nitrophenyl)pyrrolidine-3-carboxylate (PubChem CID 23735451) has the molecular formula C27H26ClN3O7S and a molecular weight of 572.04 g/mol. Its IUPAC name is methyl 1-(4-chlorophenyl)sulfonyl-5-[(4-methylphenyl)methylcarbamoyl]-2-(2-nitrophenyl)pyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(4-chlorophenyl)sulfonyl-5-[(4-methylphenyl)methylcarbamoyl]-2-(2-nitrophenyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 23735451 |
| Molecular Formula | C27H26ClN3O7S |
| Molecular Weight | 572.04 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | methyl 1-(4-chlorophenyl)sulfonyl-5-[(4-methylphenyl)methylcarbamoyl]-2-(2-nitrophenyl)pyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CC(C(=O)NCc2ccc(C)cc2)N(S(=O)(=O)c2ccc(Cl)cc2)C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H26ClN3O7S/c1-17-7-9-18(10-8-17)16-29-26(32)24-15-22(27(33)38-2)25(21-5-3-4-6-23(21)31(34)35)30(24)39(36,37)20-13-11-19(28)12-14-20/h3-14,22,24-25H,15-16H2,1-2H3,(H,29,32) |
| InChIKey | QZKJXIPUZOSWEP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.04 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|