C28H26BrN3O6 — CID 23825936
methyl 1-(2-bromobenzoyl)-5-[(4-methylphenyl)methylcarbamoyl]-2-(2-nitrophenyl)pyrrolidine-3-carboxylate (PubChem CID 23825936) has the molecular formula C28H26BrN3O6 and a molecular weight of 580.44 g/mol. Its IUPAC name is methyl 1-(2-bromobenzoyl)-5-[(4-methylphenyl)methylcarbamoyl]-2-(2-nitrophenyl)pyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(2-bromobenzoyl)-5-[(4-methylphenyl)methylcarbamoyl]-2-(2-nitrophenyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 23825936 |
| Molecular Formula | C28H26BrN3O6 |
| Molecular Weight | 580.44 g/mol |
| Exact Mass | 579.10 |
| IUPAC Name | methyl 1-(2-bromobenzoyl)-5-[(4-methylphenyl)methylcarbamoyl]-2-(2-nitrophenyl)pyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CC(C(=O)NCc2ccc(C)cc2)N(C(=O)c2ccccc2Br)C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H26BrN3O6/c1-17-11-13-18(14-12-17)16-30-26(33)24-15-21(28(35)38-2)25(20-8-4-6-10-23(20)32(36)37)31(24)27(34)19-7-3-5-9-22(19)29/h3-14,21,24-25H,15-16H2,1-2H3,(H,30,33) |
| InChIKey | ALWZWMKPGCFTQJ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|