C28H28N4O7 — CID 23820568
methyl 5-[(4-methoxyphenyl)methylcarbamoyl]-2-(3-nitrophenyl)-1-(phenylcarbamoyl)pyrrolidine-3-carboxylate (PubChem CID 23820568) has the molecular formula C28H28N4O7 and a molecular weight of 532.55 g/mol. Its IUPAC name is methyl 5-[(4-methoxyphenyl)methylcarbamoyl]-2-(3-nitrophenyl)-1-(phenylcarbamoyl)pyrrolidine-3-carboxylate.
| Compound Name | methyl 5-[(4-methoxyphenyl)methylcarbamoyl]-2-(3-nitrophenyl)-1-(phenylcarbamoyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 23820568 |
| Molecular Formula | C28H28N4O7 |
| Molecular Weight | 532.55 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | methyl 5-[(4-methoxyphenyl)methylcarbamoyl]-2-(3-nitrophenyl)-1-(phenylcarbamoyl)pyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CC(C(=O)NCc2ccc(OC)cc2)N(C(=O)Nc2ccccc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H28N4O7/c1-38-22-13-11-18(12-14-22)17-29-26(33)24-16-23(27(34)39-2)25(19-7-6-10-21(15-19)32(36)37)31(24)28(35)30-20-8-4-3-5-9-20/h3-15,23-25H,16-17H2,1-2H3,(H,29,33)(H,30,35) |
| InChIKey | GGXCSHRABQLIRC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.55 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|