C26H28FN3O7 — CID 23878867
ethyl 1-(cyclopropanecarbonyl)-5-[(4-fluorophenyl)methylcarbamoyl]-2-(4-methoxy-3-nitrophenyl)pyrrolidine-3-carboxylate (PubChem CID 23878867) has the molecular formula C26H28FN3O7 and a molecular weight of 513.52 g/mol. Its IUPAC name is ethyl 1-(cyclopropanecarbonyl)-5-[(4-fluorophenyl)methylcarbamoyl]-2-(4-methoxy-3-nitrophenyl)pyrrolidine-3-carboxylate.
| Compound Name | ethyl 1-(cyclopropanecarbonyl)-5-[(4-fluorophenyl)methylcarbamoyl]-2-(4-methoxy-3-nitrophenyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 23878867 |
| Molecular Formula | C26H28FN3O7 |
| Molecular Weight | 513.52 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | ethyl 1-(cyclopropanecarbonyl)-5-[(4-fluorophenyl)methylcarbamoyl]-2-(4-methoxy-3-nitrophenyl)pyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)C1CC(C(=O)NCc2ccc(F)cc2)N(C(=O)C2CC2)C1c1ccc(OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H28FN3O7/c1-3-37-26(33)19-13-21(24(31)28-14-15-4-9-18(27)10-5-15)29(25(32)16-6-7-16)23(19)17-8-11-22(36-2)20(12-17)30(34)35/h4-5,8-12,16,19,21,23H,3,6-7,13-14H2,1-2H3,(H,28,31) |
| InChIKey | BUWADVOYWXYNKD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|