C32H28FN3O7S — CID 23828773
methyl 5-[(4-fluorophenyl)methylcarbamoyl]-2-(4-methoxy-3-nitrophenyl)-4-phenyl-1-(thiophene-2-carbonyl)pyrrolidine-3-carboxylate (PubChem CID 23828773) has the molecular formula C32H28FN3O7S and a molecular weight of 617.66 g/mol. Its IUPAC name is methyl 5-[(4-fluorophenyl)methylcarbamoyl]-2-(4-methoxy-3-nitrophenyl)-4-phenyl-1-(thiophene-2-carbonyl)pyrrolidine-3-carboxylate.
| Compound Name | methyl 5-[(4-fluorophenyl)methylcarbamoyl]-2-(4-methoxy-3-nitrophenyl)-4-phenyl-1-(thiophene-2-carbonyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 23828773 |
| Molecular Formula | C32H28FN3O7S |
| Molecular Weight | 617.66 g/mol |
| Exact Mass | 617.16 |
| IUPAC Name | methyl 5-[(4-fluorophenyl)methylcarbamoyl]-2-(4-methoxy-3-nitrophenyl)-4-phenyl-1-(thiophene-2-carbonyl)pyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1C(c2ccccc2)C(C(=O)NCc2ccc(F)cc2)N(C(=O)c2cccs2)C1c1ccc(OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C32H28FN3O7S/c1-42-24-15-12-21(17-23(24)36(40)41)28-27(32(39)43-2)26(20-7-4-3-5-8-20)29(35(28)31(38)25-9-6-16-44-25)30(37)34-18-19-10-13-22(33)14-11-19/h3-17,26-29H,18H2,1-2H3,(H,34,37) |
| InChIKey | QYBUXRLZPHGSIZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.66 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|