C28H30N2O8S — CID 134841392
ethyl 2-[(2R,3S,4R)-2-(3,4-dimethoxyphenyl)-1-(4-methylphenyl)sulfonyl-3-nitro-3,4-dihydro-2H-quinolin-4-yl]acetate (PubChem CID 134841392) has the molecular formula C28H30N2O8S and a molecular weight of 554.62 g/mol. Its IUPAC name is ethyl 2-[(2R,3S,4R)-2-(3,4-dimethoxyphenyl)-1-(4-methylphenyl)sulfonyl-3-nitro-3,4-dihydro-2H-quinolin-4-yl]acetate.
| Compound Name | ethyl 2-[(2R,3S,4R)-2-(3,4-dimethoxyphenyl)-1-(4-methylphenyl)sulfonyl-3-nitro-3,4-dihydro-2H-quinolin-4-yl]acetate |
|---|---|
| PubChem CID | 134841392 |
| Molecular Formula | C28H30N2O8S |
| Molecular Weight | 554.62 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | ethyl 2-[(2R,3S,4R)-2-(3,4-dimethoxyphenyl)-1-(4-methylphenyl)sulfonyl-3-nitro-3,4-dihydro-2H-quinolin-4-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1c2ccccc2N(S(=O)(=O)c2ccc(C)cc2)[C@H](c2ccc(OC)c(OC)c2)[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C28H30N2O8S/c1-5-38-26(31)17-22-21-8-6-7-9-23(21)29(39(34,35)20-13-10-18(2)11-14-20)27(28(22)30(32)33)19-12-15-24(36-3)25(16-19)37-4/h6-16,22,27-28H,5,17H2,1-4H3/t22-,27-,28+/m1/s1 |
| InChIKey | ARXOYFFIGYDTNG-OFEZKSIWSA-N |
| XLogP | 4.64 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.62 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|