C60H70N2O16S4 — CID 139180663
ethyl 2-[(3S,4S,5S)-5-(2-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-4-[(4-methylphenyl)sulfonyloxymethyl]pyrrolidin-3-yl]acetate (PubChem CID 139180663) has the molecular formula C60H70N2O16S4 and a molecular weight of 1203.49 g/mol. Its IUPAC name is ethyl 2-[(3S,4S,5S)-5-(2-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-4-[(4-methylphenyl)sulfonyloxymethyl]pyrrolidin-3-yl]acetate.
| Compound Name | ethyl 2-[(3S,4S,5S)-5-(2-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-4-[(4-methylphenyl)sulfonyloxymethyl]pyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 139180663 |
| Molecular Formula | C60H70N2O16S4 |
| Molecular Weight | 1203.49 g/mol |
| Exact Mass | 1202.36 |
| IUPAC Name | ethyl 2-[(3S,4S,5S)-5-(2-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-4-[(4-methylphenyl)sulfonyloxymethyl]pyrrolidin-3-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1CN(S(=O)(=O)c2ccc(C)cc2)[C@H](c2ccccc2OC)[C@H]1COS(=O)(=O)c1ccc(C)cc1.CCOC(=O)C[C@@H]1CN(S(=O)(=O)c2ccc(C)cc2)[C@H](c2ccccc2OC)[C@H]1COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/2C30H35NO8S2/c2*1-5-38-29(32)18-23-19-31(40(33,34)24-14-10-21(2)11-15-24)30(26-8-6-7-9-28(26)37-4)27(23)20-39-41(35,36)25-16-12-22(3)13-17-25/h2*6-17,23,27,30H,5,18-20H2,1-4H3/t2*23-,27+,30-/m11/s1 |
| InChIKey | ZYYJQQFJNNTVEG-MOLVQZEESA-N |
| XLogP | 9.30 |
| TPSA | 232.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1203.49 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|