C24H23NO3S — CID 177413150
(2R,3R)-2-(2-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-3-[(E)-2-phenylethenyl]aziridine (PubChem CID 177413150) has the molecular formula C24H23NO3S and a molecular weight of 405.52 g/mol. Its IUPAC name is (2R,3R)-2-(2-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-3-[(E)-2-phenylethenyl]aziridine.
| Compound Name | (2R,3R)-2-(2-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-3-[(E)-2-phenylethenyl]aziridine |
|---|---|
| PubChem CID | 177413150 |
| Molecular Formula | C24H23NO3S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | (2R,3R)-2-(2-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-3-[(E)-2-phenylethenyl]aziridine |
| SMILES | COc1ccccc1[C@@H]1[C@@H](/C=C/c2ccccc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H23NO3S/c1-18-12-15-20(16-13-18)29(26,27)25-22(17-14-19-8-4-3-5-9-19)24(25)21-10-6-7-11-23(21)28-2/h3-17,22,24H,1-2H3/b17-14+/t22-,24-,25?/m1/s1 |
| InChIKey | OAZRWINBDWAIHJ-OPIIZHDISA-N |
| XLogP | 4.83 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|