C22H26N2O4S — CID 134924612
diethylamino 1-(4-methylphenyl)sulfonyl-3-[(E)-2-phenylethenyl]aziridine-2-carboxylate (PubChem CID 134924612) has the molecular formula C22H26N2O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is diethylamino 1-(4-methylphenyl)sulfonyl-3-[(E)-2-phenylethenyl]aziridine-2-carboxylate.
| Compound Name | diethylamino 1-(4-methylphenyl)sulfonyl-3-[(E)-2-phenylethenyl]aziridine-2-carboxylate |
|---|---|
| PubChem CID | 134924612 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | diethylamino 1-(4-methylphenyl)sulfonyl-3-[(E)-2-phenylethenyl]aziridine-2-carboxylate |
| SMILES | CCN(CC)OC(=O)C1C(/C=C/c2ccccc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H26N2O4S/c1-4-23(5-2)28-22(25)21-20(16-13-18-9-7-6-8-10-18)24(21)29(26,27)19-14-11-17(3)12-15-19/h6-16,20-21H,4-5H2,1-3H3/b16-13+ |
| InChIKey | MOXMSEHXWUKWTA-DTQAZKPQSA-N |
| XLogP | 3.25 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|