C16H20ClNO5S — CID 59342392
ethyl 1-(4-chlorophenyl)sulfonyl-6-ethyl-4-oxopiperidine-2-carboxylate (PubChem CID 59342392) has the molecular formula C16H20ClNO5S and a molecular weight of 373.86 g/mol. Its IUPAC name is ethyl 1-(4-chlorophenyl)sulfonyl-6-ethyl-4-oxopiperidine-2-carboxylate.
| Compound Name | ethyl 1-(4-chlorophenyl)sulfonyl-6-ethyl-4-oxopiperidine-2-carboxylate |
|---|---|
| PubChem CID | 59342392 |
| Molecular Formula | C16H20ClNO5S |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | ethyl 1-(4-chlorophenyl)sulfonyl-6-ethyl-4-oxopiperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CC(=O)CC(CC)N1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H20ClNO5S/c1-3-12-9-13(19)10-15(16(20)23-4-2)18(12)24(21,22)14-7-5-11(17)6-8-14/h5-8,12,15H,3-4,9-10H2,1-2H3 |
| InChIKey | URTPADRRVZETPN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |