C17H22ClNO4S — CID 58584473
methyl 2-[(2S,6S)-1-(4-chlorophenyl)sulfonyl-6-ethylpiperidin-2-yl]prop-2-enoate (PubChem CID 58584473) has the molecular formula C17H22ClNO4S and a molecular weight of 371.89 g/mol. Its IUPAC name is methyl 2-[(2S,6S)-1-(4-chlorophenyl)sulfonyl-6-ethylpiperidin-2-yl]prop-2-enoate.
| Compound Name | methyl 2-[(2S,6S)-1-(4-chlorophenyl)sulfonyl-6-ethylpiperidin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 58584473 |
| Molecular Formula | C17H22ClNO4S |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | methyl 2-[(2S,6S)-1-(4-chlorophenyl)sulfonyl-6-ethylpiperidin-2-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1CCC[C@H](CC)N1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H22ClNO4S/c1-4-14-6-5-7-16(12(2)17(20)23-3)19(14)24(21,22)15-10-8-13(18)9-11-15/h8-11,14,16H,2,4-7H2,1,3H3/t14-,16-/m0/s1 |
| InChIKey | VRKWFEJUHZPFKA-HOCLYGCPSA-N |
| XLogP | 3.39 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|