C19H31ClN2O4SSi — CID 58932468
6-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4-chlorophenyl)sulfonylpiperidine-2-carboxamide (PubChem CID 58932468) has the molecular formula C19H31ClN2O4SSi and a molecular weight of 447.07 g/mol. Its IUPAC name is 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4-chlorophenyl)sulfonylpiperidine-2-carboxamide.
| Compound Name | 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4-chlorophenyl)sulfonylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 58932468 |
| Molecular Formula | C19H31ClN2O4SSi |
| Molecular Weight | 447.07 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4-chlorophenyl)sulfonylpiperidine-2-carboxamide |
| SMILES | CC(C)(C)[Si](C)(C)OCC1CCCC(C(N)=O)N1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H31ClN2O4SSi/c1-19(2,3)28(4,5)26-13-15-7-6-8-17(18(21)23)22(15)27(24,25)16-11-9-14(20)10-12-16/h9-12,15,17H,6-8,13H2,1-5H3,(H2,21,23) |
| InChIKey | SPTWIVJUWHPLSQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.07 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|