C22H34ClN3O5S — CID 58850150
[(2S,6R)-1-(4-chlorophenyl)sulfonyl-6-(methoxymethyl)piperidin-2-yl]methyl N-(3-pyrrolidin-1-ylpropyl)carbamate (PubChem CID 58850150) has the molecular formula C22H34ClN3O5S and a molecular weight of 488.05 g/mol. Its IUPAC name is [(2S,6R)-1-(4-chlorophenyl)sulfonyl-6-(methoxymethyl)piperidin-2-yl]methyl N-(3-pyrrolidin-1-ylpropyl)carbamate.
| Compound Name | [(2S,6R)-1-(4-chlorophenyl)sulfonyl-6-(methoxymethyl)piperidin-2-yl]methyl N-(3-pyrrolidin-1-ylpropyl)carbamate |
|---|---|
| PubChem CID | 58850150 |
| Molecular Formula | C22H34ClN3O5S |
| Molecular Weight | 488.05 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | [(2S,6R)-1-(4-chlorophenyl)sulfonyl-6-(methoxymethyl)piperidin-2-yl]methyl N-(3-pyrrolidin-1-ylpropyl)carbamate |
| SMILES | COC[C@H]1CCC[C@@H](COC(=O)NCCCN2CCCC2)N1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H34ClN3O5S/c1-30-16-19-6-4-7-20(26(19)32(28,29)21-10-8-18(23)9-11-21)17-31-22(27)24-12-5-15-25-13-2-3-14-25/h8-11,19-20H,2-7,12-17H2,1H3,(H,24,27)/t19-,20+/m1/s1 |
| InChIKey | PEZWUMWFENPRSI-UXHICEINSA-N |
| XLogP | 3.11 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.05 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|