C25H29ClN4O4S — CID 10196123
[(2R,6S)-1-(4-chlorophenyl)sulfonyl-6-phenylpiperidin-2-yl]methyl N-(3-imidazol-1-ylpropyl)carbamate (PubChem CID 10196123) has the molecular formula C25H29ClN4O4S and a molecular weight of 517.05 g/mol. Its IUPAC name is [(2R,6S)-1-(4-chlorophenyl)sulfonyl-6-phenylpiperidin-2-yl]methyl N-(3-imidazol-1-ylpropyl)carbamate.
| Compound Name | [(2R,6S)-1-(4-chlorophenyl)sulfonyl-6-phenylpiperidin-2-yl]methyl N-(3-imidazol-1-ylpropyl)carbamate |
|---|---|
| PubChem CID | 10196123 |
| Molecular Formula | C25H29ClN4O4S |
| Molecular Weight | 517.05 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | [(2R,6S)-1-(4-chlorophenyl)sulfonyl-6-phenylpiperidin-2-yl]methyl N-(3-imidazol-1-ylpropyl)carbamate |
| SMILES | O=C(NCCCn1ccnc1)OC[C@H]1CCC[C@@H](c2ccccc2)N1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H29ClN4O4S/c26-21-10-12-23(13-11-21)35(32,33)30-22(8-4-9-24(30)20-6-2-1-3-7-20)18-34-25(31)28-14-5-16-29-17-15-27-19-29/h1-3,6-7,10-13,15,17,19,22,24H,4-5,8-9,14,16,18H2,(H,28,31)/t22-,24+/m1/s1 |
| InChIKey | RVSDOZHKXQWZJB-VWNXMTODSA-N |
| XLogP | 4.64 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.05 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|