C24H30ClN3O4S — CID 10163543
[1-(4-chlorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-2-yl]methyl N-(3-pyrrolidin-1-ylpropyl)carbamate (PubChem CID 10163543) has the molecular formula C24H30ClN3O4S and a molecular weight of 492.04 g/mol. Its IUPAC name is [1-(4-chlorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-2-yl]methyl N-(3-pyrrolidin-1-ylpropyl)carbamate.
| Compound Name | [1-(4-chlorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-2-yl]methyl N-(3-pyrrolidin-1-ylpropyl)carbamate |
|---|---|
| PubChem CID | 10163543 |
| Molecular Formula | C24H30ClN3O4S |
| Molecular Weight | 492.04 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | [1-(4-chlorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-2-yl]methyl N-(3-pyrrolidin-1-ylpropyl)carbamate |
| SMILES | O=C(NCCCN1CCCC1)OCC1CCc2ccccc2N1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H30ClN3O4S/c25-20-9-12-22(13-10-20)33(30,31)28-21(11-8-19-6-1-2-7-23(19)28)18-32-24(29)26-14-5-17-27-15-3-4-16-27/h1-2,6-7,9-10,12-13,21H,3-5,8,11,14-18H2,(H,26,29) |
| InChIKey | XMVXRDVOJDNQTO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.04 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|