C22H38ClN3O4S — CID 142272873
1-(4-chlorophenyl)sulfonylpiperidine;ethane;methyl N-(3-pyrrolidin-1-ylpropyl)carbamate (PubChem CID 142272873) has the molecular formula C22H38ClN3O4S and a molecular weight of 476.08 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonylpiperidine;ethane;methyl N-(3-pyrrolidin-1-ylpropyl)carbamate.
| Compound Name | 1-(4-chlorophenyl)sulfonylpiperidine;ethane;methyl N-(3-pyrrolidin-1-ylpropyl)carbamate |
|---|---|
| PubChem CID | 142272873 |
| Molecular Formula | C22H38ClN3O4S |
| Molecular Weight | 476.08 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonylpiperidine;ethane;methyl N-(3-pyrrolidin-1-ylpropyl)carbamate |
| SMILES | CC.COC(=O)NCCCN1CCCC1.O=S(=O)(c1ccc(Cl)cc1)N1CCCCC1 |
| InChI | InChI=1S/C11H14ClNO2S.C9H18N2O2.C2H6/c12-10-4-6-11(7-5-10)16(14,15)13-8-2-1-3-9-13;1-13-9(12)10-5-4-8-11-6-2-3-7-11;1-2/h4-7H,1-3,8-9H2;2-8H2,1H3,(H,10,12);1-2H3 |
| InChIKey | WLMGEAGUMOEXQT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.08 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|