C19H24ClN5O5S — CID 40785491
N'-[[(2R)-3-(4-chlorophenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N-(3-imidazol-1-ylpropyl)oxamide (PubChem CID 40785491) has the molecular formula C19H24ClN5O5S and a molecular weight of 469.95 g/mol. Its IUPAC name is N'-[[(2R)-3-(4-chlorophenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N-(3-imidazol-1-ylpropyl)oxamide.
| Compound Name | N'-[[(2R)-3-(4-chlorophenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N-(3-imidazol-1-ylpropyl)oxamide |
|---|---|
| PubChem CID | 40785491 |
| Molecular Formula | C19H24ClN5O5S |
| Molecular Weight | 469.95 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | N'-[[(2R)-3-(4-chlorophenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N-(3-imidazol-1-ylpropyl)oxamide |
| SMILES | O=C(NCCCn1ccnc1)C(=O)NC[C@H]1OCCCN1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H24ClN5O5S/c20-15-3-5-16(6-4-15)31(28,29)25-10-2-12-30-17(25)13-23-19(27)18(26)22-7-1-9-24-11-8-21-14-24/h3-6,8,11,14,17H,1-2,7,9-10,12-13H2,(H,22,26)(H,23,27)/t17-/m1/s1 |
| InChIKey | KPBUQHRAMUNKBA-QGZVFWFLSA-N |
| XLogP | 0.60 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.95 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|