C19H25N5O6S — CID 18561381
N-(3-imidazol-1-ylpropyl)-N'-[[3-(4-methoxyphenyl)sulfonyl-1,3-oxazolidin-2-yl]methyl]oxamide (PubChem CID 18561381) has the molecular formula C19H25N5O6S and a molecular weight of 451.51 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-N'-[[3-(4-methoxyphenyl)sulfonyl-1,3-oxazolidin-2-yl]methyl]oxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-N'-[[3-(4-methoxyphenyl)sulfonyl-1,3-oxazolidin-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 18561381 |
| Molecular Formula | C19H25N5O6S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-N'-[[3-(4-methoxyphenyl)sulfonyl-1,3-oxazolidin-2-yl]methyl]oxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCOC2CNC(=O)C(=O)NCCCn2ccnc2)cc1 |
| InChI | InChI=1S/C19H25N5O6S/c1-29-15-3-5-16(6-4-15)31(27,28)24-11-12-30-17(24)13-22-19(26)18(25)21-7-2-9-23-10-8-20-14-23/h3-6,8,10,14,17H,2,7,9,11-13H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | DJYBULGMMTVBNG-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 131.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|