C18H24ClNO3S — CID 58584523
2-[1-[(2S,6S)-1-(4-chlorophenyl)sulfonyl-6-ethylpiperidin-2-yl]cyclopropyl]acetaldehyde (PubChem CID 58584523) has the molecular formula C18H24ClNO3S and a molecular weight of 369.91 g/mol. Its IUPAC name is 2-[1-[(2S,6S)-1-(4-chlorophenyl)sulfonyl-6-ethylpiperidin-2-yl]cyclopropyl]acetaldehyde.
| Compound Name | 2-[1-[(2S,6S)-1-(4-chlorophenyl)sulfonyl-6-ethylpiperidin-2-yl]cyclopropyl]acetaldehyde |
|---|---|
| PubChem CID | 58584523 |
| Molecular Formula | C18H24ClNO3S |
| Molecular Weight | 369.91 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-[1-[(2S,6S)-1-(4-chlorophenyl)sulfonyl-6-ethylpiperidin-2-yl]cyclopropyl]acetaldehyde |
| SMILES | CC[C@H]1CCC[C@@H](C2(CC=O)CC2)N1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H24ClNO3S/c1-2-15-4-3-5-17(18(10-11-18)12-13-21)20(15)24(22,23)16-8-6-14(19)7-9-16/h6-9,13,15,17H,2-5,10-12H2,1H3/t15-,17-/m0/s1 |
| InChIKey | WPXROHPQJKEZPG-RDJZCZTQSA-N |
| XLogP | 4.03 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.91 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|