C27H38ClN3O3S — CID 11540894
1-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-[1-[1-(4-chlorophenyl)sulfonyl-6-cyclopropylpiperidin-2-yl]cyclopropyl]ethanone (PubChem CID 11540894) has the molecular formula C27H38ClN3O3S and a molecular weight of 520.14 g/mol. Its IUPAC name is 1-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-[1-[1-(4-chlorophenyl)sulfonyl-6-cyclopropylpiperidin-2-yl]cyclopropyl]ethanone.
| Compound Name | 1-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-[1-[1-(4-chlorophenyl)sulfonyl-6-cyclopropylpiperidin-2-yl]cyclopropyl]ethanone |
|---|---|
| PubChem CID | 11540894 |
| Molecular Formula | C27H38ClN3O3S |
| Molecular Weight | 520.14 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | 1-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-[1-[1-(4-chlorophenyl)sulfonyl-6-cyclopropylpiperidin-2-yl]cyclopropyl]ethanone |
| SMILES | O=C(CC1(C2CCCC(C3CC3)N2S(=O)(=O)c2ccc(Cl)cc2)CC1)N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C27H38ClN3O3S/c28-21-9-11-23(12-10-21)35(33,34)31-24(20-7-8-20)5-3-6-25(31)27(13-14-27)18-26(32)30-17-16-29-15-2-1-4-22(29)19-30/h9-12,20,22,24-25H,1-8,13-19H2 |
| InChIKey | JZXUGHRCBRCPON-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.14 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |