C60H56N4O16S2 — CID 139050695
ethyl (4S,4aS,9aR)-2-acetyloxy-9-(4-methylphenyl)sulfonyl-4a-nitro-4-phenyl-4,9a-dihydro-3H-carbazole-1-carboxylate (PubChem CID 139050695) has the molecular formula C60H56N4O16S2 and a molecular weight of 1153.25 g/mol. Its IUPAC name is ethyl (4S,4aS,9aR)-2-acetyloxy-9-(4-methylphenyl)sulfonyl-4a-nitro-4-phenyl-4,9a-dihydro-3H-carbazole-1-carboxylate.
| Compound Name | ethyl (4S,4aS,9aR)-2-acetyloxy-9-(4-methylphenyl)sulfonyl-4a-nitro-4-phenyl-4,9a-dihydro-3H-carbazole-1-carboxylate |
|---|---|
| PubChem CID | 139050695 |
| Molecular Formula | C60H56N4O16S2 |
| Molecular Weight | 1153.25 g/mol |
| Exact Mass | 1152.31 |
| IUPAC Name | ethyl (4S,4aS,9aR)-2-acetyloxy-9-(4-methylphenyl)sulfonyl-4a-nitro-4-phenyl-4,9a-dihydro-3H-carbazole-1-carboxylate |
| SMILES | CCOC(=O)C1=C(OC(C)=O)C[C@@H](c2ccccc2)[C@]2([N+](=O)[O-])c3ccccc3N(S(=O)(=O)c3ccc(C)cc3)[C@H]12.CCOC(=O)C1=C(OC(C)=O)C[C@@H](c2ccccc2)[C@]2([N+](=O)[O-])c3ccccc3N(S(=O)(=O)c3ccc(C)cc3)[C@H]12 |
| InChI | InChI=1S/2C30H28N2O8S/c2*1-4-39-29(34)27-26(40-20(3)33)18-24(21-10-6-5-7-11-21)30(32(35)36)23-12-8-9-13-25(23)31(28(27)30)41(37,38)22-16-14-19(2)15-17-22/h2*5-17,24,28H,4,18H2,1-3H3/t2*24-,28+,30+/m00/s1 |
| InChIKey | CKXVQWMQBCVVNN-ALHDUETCSA-N |
| XLogP | 9.22 |
| TPSA | 266.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1153.25 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|