C30H26N2O7 — CID 54750060
ethyl (4S,5R,6S)-1'-acetyl-2-hydroxy-4-(4-nitrophenyl)-2'-oxo-6-phenylspiro[cyclohexene-5,3'-indole]-1-carboxylate (PubChem CID 54750060) has the molecular formula C30H26N2O7 and a molecular weight of 526.55 g/mol. Its IUPAC name is ethyl (4S,5R,6S)-1'-acetyl-2-hydroxy-4-(4-nitrophenyl)-2'-oxo-6-phenylspiro[cyclohexene-5,3'-indole]-1-carboxylate.
| Compound Name | ethyl (4S,5R,6S)-1'-acetyl-2-hydroxy-4-(4-nitrophenyl)-2'-oxo-6-phenylspiro[cyclohexene-5,3'-indole]-1-carboxylate |
|---|---|
| PubChem CID | 54750060 |
| Molecular Formula | C30H26N2O7 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | ethyl (4S,5R,6S)-1'-acetyl-2-hydroxy-4-(4-nitrophenyl)-2'-oxo-6-phenylspiro[cyclohexene-5,3'-indole]-1-carboxylate |
| SMILES | CCOC(=O)C1=C(O)C[C@@H](c2ccc([N+](=O)[O-])cc2)[C@@]2(C(=O)N(C(C)=O)c3ccccc32)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C30H26N2O7/c1-3-39-28(35)26-25(34)17-23(19-13-15-21(16-14-19)32(37)38)30(27(26)20-9-5-4-6-10-20)22-11-7-8-12-24(22)31(18(2)33)29(30)36/h4-16,23,27,34H,3,17H2,1-2H3/t23-,27+,30+/m0/s1 |
| InChIKey | SDZAHBCBYGWUSW-NTGKZJMKSA-N |
| XLogP | 5.07 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|