C24H25NO5S — CID 10950243
methyl 2-[(4aR,9aS)-2,3-dimethyl-9-(4-methylphenyl)sulfonyl-4,9a-dihydro-1H-carbazol-4a-yl]-2-oxoacetate (PubChem CID 10950243) has the molecular formula C24H25NO5S and a molecular weight of 439.53 g/mol. Its IUPAC name is methyl 2-[(4aR,9aS)-2,3-dimethyl-9-(4-methylphenyl)sulfonyl-4,9a-dihydro-1H-carbazol-4a-yl]-2-oxoacetate.
| Compound Name | methyl 2-[(4aR,9aS)-2,3-dimethyl-9-(4-methylphenyl)sulfonyl-4,9a-dihydro-1H-carbazol-4a-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 10950243 |
| Molecular Formula | C24H25NO5S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | methyl 2-[(4aR,9aS)-2,3-dimethyl-9-(4-methylphenyl)sulfonyl-4,9a-dihydro-1H-carbazol-4a-yl]-2-oxoacetate |
| SMILES | COC(=O)C(=O)[C@@]12CC(C)=C(C)C[C@@H]1N(S(=O)(=O)c1ccc(C)cc1)c1ccccc12 |
| InChI | InChI=1S/C24H25NO5S/c1-15-9-11-18(12-10-15)31(28,29)25-20-8-6-5-7-19(20)24(22(26)23(27)30-4)14-17(3)16(2)13-21(24)25/h5-12,21H,13-14H2,1-4H3/t21-,24+/m0/s1 |
| InChIKey | KEFNXGWTADCQTD-XUZZJYLKSA-N |
| XLogP | 3.68 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|