C21H21NO3S — CID 14197486
1-[(4aR,9aS)-9-(benzenesulfonyl)-3-methyl-4,9a-dihydro-1H-carbazol-4a-yl]ethanone (PubChem CID 14197486) has the molecular formula C21H21NO3S and a molecular weight of 367.47 g/mol. Its IUPAC name is 1-[(4aR,9aS)-9-(benzenesulfonyl)-3-methyl-4,9a-dihydro-1H-carbazol-4a-yl]ethanone.
| Compound Name | 1-[(4aR,9aS)-9-(benzenesulfonyl)-3-methyl-4,9a-dihydro-1H-carbazol-4a-yl]ethanone |
|---|---|
| PubChem CID | 14197486 |
| Molecular Formula | C21H21NO3S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 1-[(4aR,9aS)-9-(benzenesulfonyl)-3-methyl-4,9a-dihydro-1H-carbazol-4a-yl]ethanone |
| SMILES | CC(=O)[C@@]12CC(C)=CC[C@@H]1N(S(=O)(=O)c1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C21H21NO3S/c1-15-12-13-20-21(14-15,16(2)23)18-10-6-7-11-19(18)22(20)26(24,25)17-8-4-3-5-9-17/h3-12,20H,13-14H2,1-2H3/t20-,21+/m0/s1 |
| InChIKey | RBTVFWFTBZOZOJ-LEWJYISDSA-N |
| XLogP | 3.83 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|