C20H21NO3S — CID 102285903
6-methyl-4-(4-phenylphenyl)sulfonyl-2-prop-1-en-2-yl-2,3-dihydro-1,4-oxazine (PubChem CID 102285903) has the molecular formula C20H21NO3S and a molecular weight of 355.46 g/mol. Its IUPAC name is 6-methyl-4-(4-phenylphenyl)sulfonyl-2-prop-1-en-2-yl-2,3-dihydro-1,4-oxazine.
| Compound Name | 6-methyl-4-(4-phenylphenyl)sulfonyl-2-prop-1-en-2-yl-2,3-dihydro-1,4-oxazine |
|---|---|
| PubChem CID | 102285903 |
| Molecular Formula | C20H21NO3S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 6-methyl-4-(4-phenylphenyl)sulfonyl-2-prop-1-en-2-yl-2,3-dihydro-1,4-oxazine |
| SMILES | C=C(C)C1CN(S(=O)(=O)c2ccc(-c3ccccc3)cc2)C=C(C)O1 |
| InChI | InChI=1S/C20H21NO3S/c1-15(2)20-14-21(13-16(3)24-20)25(22,23)19-11-9-18(10-12-19)17-7-5-4-6-8-17/h4-13,20H,1,14H2,2-3H3 |
| InChIKey | DXLSVEXWQZCUQJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|