C21H20N2O4S — CID 14983429
N-[(1R,9aR)-9-(benzenesulfonyl)-1-formyl-1,2,3,9a-tetrahydrocarbazol-4-yl]acetamide (PubChem CID 14983429) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is N-[(1R,9aR)-9-(benzenesulfonyl)-1-formyl-1,2,3,9a-tetrahydrocarbazol-4-yl]acetamide.
| Compound Name | N-[(1R,9aR)-9-(benzenesulfonyl)-1-formyl-1,2,3,9a-tetrahydrocarbazol-4-yl]acetamide |
|---|---|
| PubChem CID | 14983429 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | N-[(1R,9aR)-9-(benzenesulfonyl)-1-formyl-1,2,3,9a-tetrahydrocarbazol-4-yl]acetamide |
| SMILES | CC(=O)NC1=C2c3ccccc3N(S(=O)(=O)c3ccccc3)[C@@H]2[C@H](C=O)CC1 |
| InChI | InChI=1S/C21H20N2O4S/c1-14(25)22-18-12-11-15(13-24)21-20(18)17-9-5-6-10-19(17)23(21)28(26,27)16-7-3-2-4-8-16/h2-10,13,15,21H,11-12H2,1H3,(H,22,25)/t15-,21+/m0/s1 |
| InChIKey | FLKDTJCNTBIENW-YCRPNKLZSA-N |
| XLogP | 2.72 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|