C21H20N2O7S — CID 10026474
dimethyl (2R,3aS,8bR)-4-(benzenesulfonyl)-2-formyl-3a,8b-dihydro-1H-pyrrolo[2,3-b]indole-2,3-dicarboxylate (PubChem CID 10026474) has the molecular formula C21H20N2O7S and a molecular weight of 444.47 g/mol. Its IUPAC name is dimethyl (2R,3aS,8bR)-4-(benzenesulfonyl)-2-formyl-3a,8b-dihydro-1H-pyrrolo[2,3-b]indole-2,3-dicarboxylate.
| Compound Name | dimethyl (2R,3aS,8bR)-4-(benzenesulfonyl)-2-formyl-3a,8b-dihydro-1H-pyrrolo[2,3-b]indole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 10026474 |
| Molecular Formula | C21H20N2O7S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | dimethyl (2R,3aS,8bR)-4-(benzenesulfonyl)-2-formyl-3a,8b-dihydro-1H-pyrrolo[2,3-b]indole-2,3-dicarboxylate |
| SMILES | COC(=O)N1[C@@H]2[C@H](C[C@@]1(C=O)C(=O)OC)c1ccccc1N2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H20N2O7S/c1-29-19(25)21(13-24)12-16-15-10-6-7-11-17(15)23(18(16)22(21)20(26)30-2)31(27,28)14-8-4-3-5-9-14/h3-11,13,16,18H,12H2,1-2H3/t16-,18+,21-/m1/s1 |
| InChIKey | WXACWEQXYMHRRQ-PLMTUMEDSA-N |
| XLogP | 1.89 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|