C29H27NO6S — CID 135069160
dimethyl 5-(4-methylphenyl)sulfonyl-3-phenyl-4,9b-dihydro-1H-cyclopenta[c]quinoline-2,2-dicarboxylate (PubChem CID 135069160) has the molecular formula C29H27NO6S and a molecular weight of 517.60 g/mol. Its IUPAC name is dimethyl 5-(4-methylphenyl)sulfonyl-3-phenyl-4,9b-dihydro-1H-cyclopenta[c]quinoline-2,2-dicarboxylate.
| Compound Name | dimethyl 5-(4-methylphenyl)sulfonyl-3-phenyl-4,9b-dihydro-1H-cyclopenta[c]quinoline-2,2-dicarboxylate |
|---|---|
| PubChem CID | 135069160 |
| Molecular Formula | C29H27NO6S |
| Molecular Weight | 517.60 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | dimethyl 5-(4-methylphenyl)sulfonyl-3-phenyl-4,9b-dihydro-1H-cyclopenta[c]quinoline-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2C(=C1c1ccccc1)CN(S(=O)(=O)c1ccc(C)cc1)c1ccccc12 |
| InChI | InChI=1S/C29H27NO6S/c1-19-13-15-21(16-14-19)37(33,34)30-18-24-23(22-11-7-8-12-25(22)30)17-29(27(31)35-2,28(32)36-3)26(24)20-9-5-4-6-10-20/h4-16,23H,17-18H2,1-3H3 |
| InChIKey | YQJOSMJAMJRKFK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.60 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|