C24H28N2O6S — CID 102125233
dimethyl (2R,3aR,8bS)-4-(4-tert-butylphenyl)sulfonyl-1,2,3a,8b-tetrahydropyrrolo[2,3-b]indole-2,3-dicarboxylate (PubChem CID 102125233) has the molecular formula C24H28N2O6S and a molecular weight of 472.56 g/mol. Its IUPAC name is dimethyl (2R,3aR,8bS)-4-(4-tert-butylphenyl)sulfonyl-1,2,3a,8b-tetrahydropyrrolo[2,3-b]indole-2,3-dicarboxylate.
| Compound Name | dimethyl (2R,3aR,8bS)-4-(4-tert-butylphenyl)sulfonyl-1,2,3a,8b-tetrahydropyrrolo[2,3-b]indole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 102125233 |
| Molecular Formula | C24H28N2O6S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | dimethyl (2R,3aR,8bS)-4-(4-tert-butylphenyl)sulfonyl-1,2,3a,8b-tetrahydropyrrolo[2,3-b]indole-2,3-dicarboxylate |
| SMILES | COC(=O)[C@H]1C[C@H]2c3ccccc3N(S(=O)(=O)c3ccc(C(C)(C)C)cc3)[C@H]2N1C(=O)OC |
| InChI | InChI=1S/C24H28N2O6S/c1-24(2,3)15-10-12-16(13-11-15)33(29,30)26-19-9-7-6-8-17(19)18-14-20(22(27)31-4)25(21(18)26)23(28)32-5/h6-13,18,20-21H,14H2,1-5H3/t18-,20+,21+/m0/s1 |
| InChIKey | ZIPPIMKSHPGFAH-CEWLAPEOSA-N |
| XLogP | 3.62 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |