C23H24N2O8S — CID 10972985
dimethyl (2R,3aS,8bR)-4-(benzenesulfonyl)-2-(2-methoxy-2-oxoethyl)-3a,8b-dihydro-1H-pyrrolo[2,3-b]indole-2,3-dicarboxylate (PubChem CID 10972985) has the molecular formula C23H24N2O8S and a molecular weight of 488.52 g/mol. Its IUPAC name is dimethyl (2R,3aS,8bR)-4-(benzenesulfonyl)-2-(2-methoxy-2-oxoethyl)-3a,8b-dihydro-1H-pyrrolo[2,3-b]indole-2,3-dicarboxylate.
| Compound Name | dimethyl (2R,3aS,8bR)-4-(benzenesulfonyl)-2-(2-methoxy-2-oxoethyl)-3a,8b-dihydro-1H-pyrrolo[2,3-b]indole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 10972985 |
| Molecular Formula | C23H24N2O8S |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | dimethyl (2R,3aS,8bR)-4-(benzenesulfonyl)-2-(2-methoxy-2-oxoethyl)-3a,8b-dihydro-1H-pyrrolo[2,3-b]indole-2,3-dicarboxylate |
| SMILES | COC(=O)C[C@@]1(C(=O)OC)C[C@@H]2c3ccccc3N(S(=O)(=O)c3ccccc3)[C@@H]2N1C(=O)OC |
| InChI | InChI=1S/C23H24N2O8S/c1-31-19(26)14-23(21(27)32-2)13-17-16-11-7-8-12-18(16)25(20(17)24(23)22(28)33-3)34(29,30)15-9-5-4-6-10-15/h4-12,17,20H,13-14H2,1-3H3/t17-,20+,23-/m1/s1 |
| InChIKey | KPXKJSSBBPGWKM-DHJUGAMNSA-N |
| XLogP | 2.25 |
| TPSA | 119.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|