C32H32N2O7 — CID 11017149
3-O,4-O-dibenzyl 2-O-prop-2-enyl (2S,3aS,8bS)-2-(methoxymethyl)-3a,8b-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate (PubChem CID 11017149) has the molecular formula C32H32N2O7 and a molecular weight of 556.62 g/mol. Its IUPAC name is 3-O,4-O-dibenzyl 2-O-prop-2-enyl (2S,3aS,8bS)-2-(methoxymethyl)-3a,8b-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate.
| Compound Name | 3-O,4-O-dibenzyl 2-O-prop-2-enyl (2S,3aS,8bS)-2-(methoxymethyl)-3a,8b-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 11017149 |
| Molecular Formula | C32H32N2O7 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | 3-O,4-O-dibenzyl 2-O-prop-2-enyl (2S,3aS,8bS)-2-(methoxymethyl)-3a,8b-dihydro-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate |
| SMILES | C=CCOC(=O)[C@@]1(COC)C[C@H]2c3ccccc3N(C(=O)OCc3ccccc3)[C@H]2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H32N2O7/c1-3-18-39-29(35)32(22-38-2)19-26-25-16-10-11-17-27(25)33(30(36)40-20-23-12-6-4-7-13-23)28(26)34(32)31(37)41-21-24-14-8-5-9-15-24/h3-17,26,28H,1,18-22H2,2H3/t26-,28-,32-/m0/s1 |
| InChIKey | LNEKBHYZMUXENB-XKVYUHEQSA-N |
| XLogP | 5.41 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|