C19H20N2O4S — CID 10384653
methyl (2R,3aS,8bR)-4-(benzenesulfonyl)-2-methyl-1,2,3a,8b-tetrahydropyrrolo[2,3-b]indole-3-carboxylate (PubChem CID 10384653) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is methyl (2R,3aS,8bR)-4-(benzenesulfonyl)-2-methyl-1,2,3a,8b-tetrahydropyrrolo[2,3-b]indole-3-carboxylate.
| Compound Name | methyl (2R,3aS,8bR)-4-(benzenesulfonyl)-2-methyl-1,2,3a,8b-tetrahydropyrrolo[2,3-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 10384653 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | methyl (2R,3aS,8bR)-4-(benzenesulfonyl)-2-methyl-1,2,3a,8b-tetrahydropyrrolo[2,3-b]indole-3-carboxylate |
| SMILES | COC(=O)N1[C@H](C)C[C@@H]2c3ccccc3N(S(=O)(=O)c3ccccc3)[C@@H]21 |
| InChI | InChI=1S/C19H20N2O4S/c1-13-12-16-15-10-6-7-11-17(15)21(18(16)20(13)19(22)25-2)26(23,24)14-8-4-3-5-9-14/h3-11,13,16,18H,12H2,1-2H3/t13-,16-,18+/m1/s1 |
| InChIKey | MLJYQWWRYPWNEN-QBIMZIAESA-N |
| XLogP | 3.17 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |