C27H24N2O8S — CID 134954714
methyl (2R,3S,4R)-2-(1,3-benzodioxol-5-yl)-4-ethenyl-1-(4-methylphenyl)sulfonyl-3-nitro-2,4-dihydroquinoline-3-carboxylate (PubChem CID 134954714) has the molecular formula C27H24N2O8S and a molecular weight of 536.56 g/mol. Its IUPAC name is methyl (2R,3S,4R)-2-(1,3-benzodioxol-5-yl)-4-ethenyl-1-(4-methylphenyl)sulfonyl-3-nitro-2,4-dihydroquinoline-3-carboxylate.
| Compound Name | methyl (2R,3S,4R)-2-(1,3-benzodioxol-5-yl)-4-ethenyl-1-(4-methylphenyl)sulfonyl-3-nitro-2,4-dihydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 134954714 |
| Molecular Formula | C27H24N2O8S |
| Molecular Weight | 536.56 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | methyl (2R,3S,4R)-2-(1,3-benzodioxol-5-yl)-4-ethenyl-1-(4-methylphenyl)sulfonyl-3-nitro-2,4-dihydroquinoline-3-carboxylate |
| SMILES | C=C[C@@H]1c2ccccc2N(S(=O)(=O)c2ccc(C)cc2)[C@H](c2ccc3c(c2)OCO3)[C@@]1(C(=O)OC)[N+](=O)[O-] |
| InChI | InChI=1S/C27H24N2O8S/c1-4-21-20-7-5-6-8-22(20)28(38(33,34)19-12-9-17(2)10-13-19)25(27(21,29(31)32)26(30)35-3)18-11-14-23-24(15-18)37-16-36-23/h4-15,21,25H,1,16H2,2-3H3/t21-,25-,27+/m1/s1 |
| InChIKey | VHJLKIMQXWSJDJ-RMXYQJDTSA-N |
| XLogP | 4.13 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|