C19H17NO6S — CID 45276394
methyl 2-[(E)-C-(1,3-benzodioxol-5-yl)-N-(4-methylphenyl)sulfonylcarbonimidoyl]prop-2-enoate (PubChem CID 45276394) has the molecular formula C19H17NO6S and a molecular weight of 387.41 g/mol. Its IUPAC name is methyl 2-[(E)-C-(1,3-benzodioxol-5-yl)-N-(4-methylphenyl)sulfonylcarbonimidoyl]prop-2-enoate.
| Compound Name | methyl 2-[(E)-C-(1,3-benzodioxol-5-yl)-N-(4-methylphenyl)sulfonylcarbonimidoyl]prop-2-enoate |
|---|---|
| PubChem CID | 45276394 |
| Molecular Formula | C19H17NO6S |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | methyl 2-[(E)-C-(1,3-benzodioxol-5-yl)-N-(4-methylphenyl)sulfonylcarbonimidoyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)/C(=N/S(=O)(=O)c1ccc(C)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H17NO6S/c1-12-4-7-15(8-5-12)27(22,23)20-18(13(2)19(21)24-3)14-6-9-16-17(10-14)26-11-25-16/h4-10H,2,11H2,1,3H3/b20-18- |
| InChIKey | BOHXINROXJSOCH-ZZEZOPTASA-N |
| XLogP | 2.63 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|