C13H12O6 — CID 4736883
methyl 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,4-dioxobutanoate (PubChem CID 4736883) has the molecular formula C13H12O6 and a molecular weight of 264.23 g/mol. Its IUPAC name is methyl 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,4-dioxobutanoate.
| Compound Name | methyl 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 4736883 |
| Molecular Formula | C13H12O6 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | methyl 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,4-dioxobutanoate |
| SMILES | COC(=O)C(=O)CC(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C13H12O6/c1-17-13(16)10(15)7-9(14)8-2-3-11-12(6-8)19-5-4-18-11/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | YFHDIUJBCCTRSM-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|