C29H25N3O4S — CID 102410652
methyl 4-[(2R,4R)-3,3-dicyano-4-ethenyl-7-methyl-1-(4-methylphenyl)sulfonyl-2,4-dihydroquinolin-2-yl]benzoate (PubChem CID 102410652) has the molecular formula C29H25N3O4S and a molecular weight of 511.60 g/mol. Its IUPAC name is methyl 4-[(2R,4R)-3,3-dicyano-4-ethenyl-7-methyl-1-(4-methylphenyl)sulfonyl-2,4-dihydroquinolin-2-yl]benzoate.
| Compound Name | methyl 4-[(2R,4R)-3,3-dicyano-4-ethenyl-7-methyl-1-(4-methylphenyl)sulfonyl-2,4-dihydroquinolin-2-yl]benzoate |
|---|---|
| PubChem CID | 102410652 |
| Molecular Formula | C29H25N3O4S |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | methyl 4-[(2R,4R)-3,3-dicyano-4-ethenyl-7-methyl-1-(4-methylphenyl)sulfonyl-2,4-dihydroquinolin-2-yl]benzoate |
| SMILES | C=C[C@@H]1c2ccc(C)cc2N(S(=O)(=O)c2ccc(C)cc2)[C@H](c2ccc(C(=O)OC)cc2)C1(C#N)C#N |
| InChI | InChI=1S/C29H25N3O4S/c1-5-25-24-15-8-20(3)16-26(24)32(37(34,35)23-13-6-19(2)7-14-23)27(29(25,17-30)18-31)21-9-11-22(12-10-21)28(33)36-4/h5-16,25,27H,1H2,2-4H3/t25-,27-/m1/s1 |
| InChIKey | WZELBJFSLLUOQL-XNMGPUDCSA-N |
| XLogP | 5.34 |
| TPSA | 111.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|