C25H24BrNO5S — CID 102291080
methyl 4-[(4S,5R)-4-bromo-2-(4-methylphenyl)sulfonyl-9-oxo-2-azaspiro[5.5]undeca-7,10-dien-5-yl]benzoate (PubChem CID 102291080) has the molecular formula C25H24BrNO5S and a molecular weight of 530.44 g/mol. Its IUPAC name is methyl 4-[(4S,5R)-4-bromo-2-(4-methylphenyl)sulfonyl-9-oxo-2-azaspiro[5.5]undeca-7,10-dien-5-yl]benzoate.
| Compound Name | methyl 4-[(4S,5R)-4-bromo-2-(4-methylphenyl)sulfonyl-9-oxo-2-azaspiro[5.5]undeca-7,10-dien-5-yl]benzoate |
|---|---|
| PubChem CID | 102291080 |
| Molecular Formula | C25H24BrNO5S |
| Molecular Weight | 530.44 g/mol |
| Exact Mass | 529.06 |
| IUPAC Name | methyl 4-[(4S,5R)-4-bromo-2-(4-methylphenyl)sulfonyl-9-oxo-2-azaspiro[5.5]undeca-7,10-dien-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2[C@H](Br)CN(S(=O)(=O)c3ccc(C)cc3)CC23C=CC(=O)C=C3)cc1 |
| InChI | InChI=1S/C25H24BrNO5S/c1-17-3-9-21(10-4-17)33(30,31)27-15-22(26)23(25(16-27)13-11-20(28)12-14-25)18-5-7-19(8-6-18)24(29)32-2/h3-14,22-23H,15-16H2,1-2H3/t22-,23?/m1/s1 |
| InChIKey | SLOCERJDLQCBKH-WTQRLHSKSA-N |
| XLogP | 4.01 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|